C25H31N3O — CID 23133797
4-(4-benzylpiperazin-1-yl)-1-(3-methoxyphenyl)cyclohexane-1-carbonitrile (PubChem CID 23133797) has the molecular formula C25H31N3O and a molecular weight of 389.54 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)-1-(3-methoxyphenyl)cyclohexane-1-carbonitrile.
| Compound Name | 4-(4-benzylpiperazin-1-yl)-1-(3-methoxyphenyl)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 23133797 |
| Molecular Formula | C25H31N3O |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)-1-(3-methoxyphenyl)cyclohexane-1-carbonitrile |
| SMILES | COc1cccc(C2(C#N)CCC(N3CCN(Cc4ccccc4)CC3)CC2)c1 |
| InChI | InChI=1S/C25H31N3O/c1-29-24-9-5-8-22(18-24)25(20-26)12-10-23(11-13-25)28-16-14-27(15-17-28)19-21-6-3-2-4-7-21/h2-9,18,23H,10-17,19H2,1H3 |
| InChIKey | XEYNKYYDWUJFKD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 39.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |