C21H26O2 — CID 174602942
butyl (E)-3-(1,5-dimethyl-4-phenylcyclohexa-2,4-dien-1-yl)prop-2-enoate (PubChem CID 174602942) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is butyl (E)-3-(1,5-dimethyl-4-phenylcyclohexa-2,4-dien-1-yl)prop-2-enoate.
| Compound Name | butyl (E)-3-(1,5-dimethyl-4-phenylcyclohexa-2,4-dien-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 174602942 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | butyl (E)-3-(1,5-dimethyl-4-phenylcyclohexa-2,4-dien-1-yl)prop-2-enoate |
| SMILES | CCCCOC(=O)/C=C/C1(C)C=CC(c2ccccc2)=C(C)C1 |
| InChI | InChI=1S/C21H26O2/c1-4-5-15-23-20(22)12-14-21(3)13-11-19(17(2)16-21)18-9-7-6-8-10-18/h6-14H,4-5,15-16H2,1-3H3/b14-12+ |
| InChIKey | WXDSRJOVJPHZPE-WYMLVPIESA-N |
| XLogP | 5.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|