C20H23ClO2 — CID 174602939
butyl (E)-3-(1-chloro-5-methyl-4-phenylcyclohexa-2,4-dien-1-yl)prop-2-enoate (PubChem CID 174602939) has the molecular formula C20H23ClO2 and a molecular weight of 330.86 g/mol. Its IUPAC name is butyl (E)-3-(1-chloro-5-methyl-4-phenylcyclohexa-2,4-dien-1-yl)prop-2-enoate.
| Compound Name | butyl (E)-3-(1-chloro-5-methyl-4-phenylcyclohexa-2,4-dien-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 174602939 |
| Molecular Formula | C20H23ClO2 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | butyl (E)-3-(1-chloro-5-methyl-4-phenylcyclohexa-2,4-dien-1-yl)prop-2-enoate |
| SMILES | CCCCOC(=O)/C=C/C1(Cl)C=CC(c2ccccc2)=C(C)C1 |
| InChI | InChI=1S/C20H23ClO2/c1-3-4-14-23-19(22)11-13-20(21)12-10-18(16(2)15-20)17-8-6-5-7-9-17/h5-13H,3-4,14-15H2,1-2H3/b13-11+ |
| InChIKey | WPMRFBPYLCJXLT-ACCUITESSA-N |
| XLogP | 5.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|