C12H14Cl4N2 — CID 175597571
4-(4-aminophenyl)-1,5-dichlorocyclohexa-2,4-dien-1-amine;dihydrochloride (PubChem CID 175597571) has the molecular formula C12H14Cl4N2 and a molecular weight of 328.07 g/mol. Its IUPAC name is 4-(4-aminophenyl)-1,5-dichlorocyclohexa-2,4-dien-1-amine;dihydrochloride.
| Compound Name | 4-(4-aminophenyl)-1,5-dichlorocyclohexa-2,4-dien-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 175597571 |
| Molecular Formula | C12H14Cl4N2 |
| Molecular Weight | 328.07 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 4-(4-aminophenyl)-1,5-dichlorocyclohexa-2,4-dien-1-amine;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(C2=C(Cl)CC(N)(Cl)C=C2)cc1 |
| InChI | InChI=1S/C12H12Cl2N2.2ClH/c13-11-7-12(14,16)6-5-10(11)8-1-3-9(15)4-2-8;;/h1-6H,7,15-16H2;2*1H |
| InChIKey | KZZGAPKDSVCFTN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.07 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|