C12H16N4 — CID 69280417
4-(4-aminophenyl)cyclohexa-3,5-diene-1,1,2-triamine (PubChem CID 69280417) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 4-(4-aminophenyl)cyclohexa-3,5-diene-1,1,2-triamine.
| Compound Name | 4-(4-aminophenyl)cyclohexa-3,5-diene-1,1,2-triamine |
|---|---|
| PubChem CID | 69280417 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 4-(4-aminophenyl)cyclohexa-3,5-diene-1,1,2-triamine |
| SMILES | Nc1ccc(C2=CC(N)C(N)(N)C=C2)cc1 |
| InChI | InChI=1S/C12H16N4/c13-10-3-1-8(2-4-10)9-5-6-12(15,16)11(14)7-9/h1-7,11H,13-16H2 |
| InChIKey | GSEGBPHJMPRLKA-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|