C14H18N2O2 — CID 151570595
4-(4-aminophenyl)-1,6-dimethoxycyclohexa-2,4-dien-1-amine (PubChem CID 151570595) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 4-(4-aminophenyl)-1,6-dimethoxycyclohexa-2,4-dien-1-amine.
| Compound Name | 4-(4-aminophenyl)-1,6-dimethoxycyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 151570595 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 4-(4-aminophenyl)-1,6-dimethoxycyclohexa-2,4-dien-1-amine |
| SMILES | COC1C=C(c2ccc(N)cc2)C=CC1(N)OC |
| InChI | InChI=1S/C14H18N2O2/c1-17-13-9-11(7-8-14(13,16)18-2)10-3-5-12(15)6-4-10/h3-9,13H,15-16H2,1-2H3 |
| InChIKey | QEJBFRVZOKRORJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|