C32H38N2O2 — CID 19025154
4-[1-(4-aminophenoxy)-6,6-ditert-butyl-4-phenylcyclohexa-2,4-dien-1-yl]oxyaniline (PubChem CID 19025154) has the molecular formula C32H38N2O2 and a molecular weight of 482.67 g/mol. Its IUPAC name is 4-[1-(4-aminophenoxy)-6,6-ditert-butyl-4-phenylcyclohexa-2,4-dien-1-yl]oxyaniline.
| Compound Name | 4-[1-(4-aminophenoxy)-6,6-ditert-butyl-4-phenylcyclohexa-2,4-dien-1-yl]oxyaniline |
|---|---|
| PubChem CID | 19025154 |
| Molecular Formula | C32H38N2O2 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | 4-[1-(4-aminophenoxy)-6,6-ditert-butyl-4-phenylcyclohexa-2,4-dien-1-yl]oxyaniline |
| SMILES | CC(C)(C)C1(C(C)(C)C)C=C(c2ccccc2)C=CC1(Oc1ccc(N)cc1)Oc1ccc(N)cc1 |
| InChI | InChI=1S/C32H38N2O2/c1-29(2,3)31(30(4,5)6)22-24(23-10-8-7-9-11-23)20-21-32(31,35-27-16-12-25(33)13-17-27)36-28-18-14-26(34)15-19-28/h7-22H,33-34H2,1-6H3 |
| InChIKey | TYTUWPBYHRNBEF-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|