C38H30N2O4 — CID 175865652
[1-(4-aminophenoxy)-4-[4-(4-aminophenoxy)-4-benzoylcyclohexa-2,5-dien-1-ylidene]cyclohexa-2,5-dien-1-yl]-phenylmethanone (PubChem CID 175865652) has the molecular formula C38H30N2O4 and a molecular weight of 578.67 g/mol. Its IUPAC name is [1-(4-aminophenoxy)-4-[4-(4-aminophenoxy)-4-benzoylcyclohexa-2,5-dien-1-ylidene]cyclohexa-2,5-dien-1-yl]-phenylmethanone.
| Compound Name | [1-(4-aminophenoxy)-4-[4-(4-aminophenoxy)-4-benzoylcyclohexa-2,5-dien-1-ylidene]cyclohexa-2,5-dien-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 175865652 |
| Molecular Formula | C38H30N2O4 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | [1-(4-aminophenoxy)-4-[4-(4-aminophenoxy)-4-benzoylcyclohexa-2,5-dien-1-ylidene]cyclohexa-2,5-dien-1-yl]-phenylmethanone |
| SMILES | Nc1ccc(OC2(C(=O)c3ccccc3)C=CC(=C3C=CC(Oc4ccc(N)cc4)(C(=O)c4ccccc4)C=C3)C=C2)cc1 |
| InChI | InChI=1S/C38H30N2O4/c39-31-11-15-33(16-12-31)43-37(35(41)29-7-3-1-4-8-29)23-19-27(20-24-37)28-21-25-38(26-22-28,36(42)30-9-5-2-6-10-30)44-34-17-13-32(40)14-18-34/h1-26H,39-40H2/b28-27- |
| InChIKey | JDNYWLXGNUIFMX-DQSJHHFOSA-N |
| XLogP | 7.10 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|