C19H18FNO2 — CID 69047686
2-fluoro-6-(6-methoxy-1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)oxypyridine (PubChem CID 69047686) has the molecular formula C19H18FNO2 and a molecular weight of 311.36 g/mol. Its IUPAC name is 2-fluoro-6-(6-methoxy-1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)oxypyridine.
| Compound Name | 2-fluoro-6-(6-methoxy-1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)oxypyridine |
|---|---|
| PubChem CID | 69047686 |
| Molecular Formula | C19H18FNO2 |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-fluoro-6-(6-methoxy-1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)oxypyridine |
| SMILES | COC1C=C(c2ccccc2)C=CC1(C)Oc1cccc(F)n1 |
| InChI | InChI=1S/C19H18FNO2/c1-19(23-18-10-6-9-17(20)21-18)12-11-15(13-16(19)22-2)14-7-4-3-5-8-14/h3-13,16H,1-2H3 |
| InChIKey | LYSRXCIIDRYUMQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|