C16H15IO4 — CID 175132782
dimethyl 5-iodo-4-phenylcyclohexa-2,4-diene-1,1-dicarboxylate (PubChem CID 175132782) has the molecular formula C16H15IO4 and a molecular weight of 398.20 g/mol. Its IUPAC name is dimethyl 5-iodo-4-phenylcyclohexa-2,4-diene-1,1-dicarboxylate.
| Compound Name | dimethyl 5-iodo-4-phenylcyclohexa-2,4-diene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 175132782 |
| Molecular Formula | C16H15IO4 |
| Molecular Weight | 398.20 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | dimethyl 5-iodo-4-phenylcyclohexa-2,4-diene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C=CC(c2ccccc2)=C(I)C1 |
| InChI | InChI=1S/C16H15IO4/c1-20-14(18)16(15(19)21-2)9-8-12(13(17)10-16)11-6-4-3-5-7-11/h3-9H,10H2,1-2H3 |
| InChIKey | KYJZHQRATMRLLJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.20 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|