C18H14F6O4 — CID 175094827
methyl 5-formyl-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-phenylcyclohexa-1,3-diene-1-carboxylate (PubChem CID 175094827) has the molecular formula C18H14F6O4 and a molecular weight of 408.29 g/mol. Its IUPAC name is methyl 5-formyl-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-phenylcyclohexa-1,3-diene-1-carboxylate.
| Compound Name | methyl 5-formyl-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-phenylcyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 175094827 |
| Molecular Formula | C18H14F6O4 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | methyl 5-formyl-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-phenylcyclohexa-1,3-diene-1-carboxylate |
| SMILES | COC(=O)C1=C(c2ccccc2)C=CC(C=O)(C(O)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C18H14F6O4/c1-28-14(26)13-9-15(10-25,16(27,17(19,20)21)18(22,23)24)8-7-12(13)11-5-3-2-4-6-11/h2-8,10,27H,9H2,1H3 |
| InChIKey | OISPTPHMNMBASV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|