C27H26F7NO5S — CID 141421726
methyl 4-[[[5-fluoro-1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-phenylcyclohexa-2,4-dien-1-yl]-propylsulfamoyl]methyl]benzoate (PubChem CID 141421726) has the molecular formula C27H26F7NO5S and a molecular weight of 609.56 g/mol. Its IUPAC name is methyl 4-[[[5-fluoro-1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-phenylcyclohexa-2,4-dien-1-yl]-propylsulfamoyl]methyl]benzoate.
| Compound Name | methyl 4-[[[5-fluoro-1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-phenylcyclohexa-2,4-dien-1-yl]-propylsulfamoyl]methyl]benzoate |
|---|---|
| PubChem CID | 141421726 |
| Molecular Formula | C27H26F7NO5S |
| Molecular Weight | 609.56 g/mol |
| Exact Mass | 609.14 |
| IUPAC Name | methyl 4-[[[5-fluoro-1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-phenylcyclohexa-2,4-dien-1-yl]-propylsulfamoyl]methyl]benzoate |
| SMILES | CCCN(C1(C(O)(C(F)(F)F)C(F)(F)F)C=CC(c2ccccc2)=C(F)C1)S(=O)(=O)Cc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C27H26F7NO5S/c1-3-15-35(41(38,39)17-18-9-11-20(12-10-18)23(36)40-2)24(25(37,26(29,30)31)27(32,33)34)14-13-21(22(28)16-24)19-7-5-4-6-8-19/h4-14,37H,3,15-17H2,1-2H3 |
| InChIKey | UPJPYTAVEOPBIZ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.56 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |