C16H10F8O2 — CID 175242113
3,5-difluoro-1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-phenylcyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 175242113) has the molecular formula C16H10F8O2 and a molecular weight of 386.24 g/mol. Its IUPAC name is 3,5-difluoro-1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-phenylcyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | 3,5-difluoro-1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-phenylcyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 175242113 |
| Molecular Formula | C16H10F8O2 |
| Molecular Weight | 386.24 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 3,5-difluoro-1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-phenylcyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | O=CC1(C(O)(C(F)(F)F)C(F)(F)F)C=C(F)C(c2ccccc2)=C(F)C1 |
| InChI | InChI=1S/C16H10F8O2/c17-10-6-13(8-25,14(26,15(19,20)21)16(22,23)24)7-11(18)12(10)9-4-2-1-3-5-9/h1-6,8,26H,7H2 |
| InChIKey | NRQSPSSYBQYEHW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.24 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|