C20H20F8O2 — CID 175085549
3,6-difluoro-1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-methyl-4-phenyl-5-propan-2-ylcyclohex-3-ene-1-carbaldehyde (PubChem CID 175085549) has the molecular formula C20H20F8O2 and a molecular weight of 444.36 g/mol. Its IUPAC name is 3,6-difluoro-1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-methyl-4-phenyl-5-propan-2-ylcyclohex-3-ene-1-carbaldehyde.
| Compound Name | 3,6-difluoro-1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-methyl-4-phenyl-5-propan-2-ylcyclohex-3-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 175085549 |
| Molecular Formula | C20H20F8O2 |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 3,6-difluoro-1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-methyl-4-phenyl-5-propan-2-ylcyclohex-3-ene-1-carbaldehyde |
| SMILES | CC(C)C1(C)C(c2ccccc2)=C(F)CC(C=O)(C(O)(C(F)(F)F)C(F)(F)F)C1F |
| InChI | InChI=1S/C20H20F8O2/c1-11(2)16(3)14(12-7-5-4-6-8-12)13(21)9-17(10-29,15(16)22)18(30,19(23,24)25)20(26,27)28/h4-8,10-11,15,30H,9H2,1-3H3 |
| InChIKey | NLCLBQYHMCQDEJ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|