C24H29F4NO5 — CID 175300317
methyl 4-methyl-2-[[2,2,2-trifluoro-1-[5-fluoro-2-formyl-5-(methoxymethoxy)-4-phenylcyclohexa-1,3-dien-1-yl]ethyl]amino]pentanoate (PubChem CID 175300317) has the molecular formula C24H29F4NO5 and a molecular weight of 487.49 g/mol. Its IUPAC name is methyl 4-methyl-2-[[2,2,2-trifluoro-1-[5-fluoro-2-formyl-5-(methoxymethoxy)-4-phenylcyclohexa-1,3-dien-1-yl]ethyl]amino]pentanoate.
| Compound Name | methyl 4-methyl-2-[[2,2,2-trifluoro-1-[5-fluoro-2-formyl-5-(methoxymethoxy)-4-phenylcyclohexa-1,3-dien-1-yl]ethyl]amino]pentanoate |
|---|---|
| PubChem CID | 175300317 |
| Molecular Formula | C24H29F4NO5 |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | methyl 4-methyl-2-[[2,2,2-trifluoro-1-[5-fluoro-2-formyl-5-(methoxymethoxy)-4-phenylcyclohexa-1,3-dien-1-yl]ethyl]amino]pentanoate |
| SMILES | COCOC1(F)CC(C(NC(CC(C)C)C(=O)OC)C(F)(F)F)=C(C=O)C=C1c1ccccc1 |
| InChI | InChI=1S/C24H29F4NO5/c1-15(2)10-20(22(31)33-4)29-21(24(26,27)28)18-12-23(25,34-14-32-3)19(11-17(18)13-30)16-8-6-5-7-9-16/h5-9,11,13,15,20-21,29H,10,12,14H2,1-4H3 |
| InChIKey | DIJLLVOOTHVVSQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|