C25H21Cl2F6NO5S — CID 175174479
N-[3,5-dichloro-1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-phenylcyclohexa-2,4-dien-1-yl]-3-hydroxy-2-(4-methylsulfonylphenyl)propanamide (PubChem CID 175174479) has the molecular formula C25H21Cl2F6NO5S and a molecular weight of 632.41 g/mol. Its IUPAC name is N-[3,5-dichloro-1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-phenylcyclohexa-2,4-dien-1-yl]-3-hydroxy-2-(4-methylsulfonylphenyl)propanamide.
| Compound Name | N-[3,5-dichloro-1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-phenylcyclohexa-2,4-dien-1-yl]-3-hydroxy-2-(4-methylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 175174479 |
| Molecular Formula | C25H21Cl2F6NO5S |
| Molecular Weight | 632.41 g/mol |
| Exact Mass | 631.04 |
| IUPAC Name | N-[3,5-dichloro-1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-phenylcyclohexa-2,4-dien-1-yl]-3-hydroxy-2-(4-methylsulfonylphenyl)propanamide |
| SMILES | CS(=O)(=O)c1ccc(C(CO)C(=O)NC2(C(O)(C(F)(F)F)C(F)(F)F)C=C(Cl)C(c3ccccc3)=C(Cl)C2)cc1 |
| InChI | InChI=1S/C25H21Cl2F6NO5S/c1-40(38,39)16-9-7-14(8-10-16)17(13-35)21(36)34-22(23(37,24(28,29)30)25(31,32)33)11-18(26)20(19(27)12-22)15-5-3-2-4-6-15/h2-11,17,35,37H,12-13H2,1H3,(H,34,36) |
| InChIKey | OZGVKVLYAVENKQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |