C31H23Cl2F3N2O6S — CID 175185920
N-[3,5-dichloro-4-phenyl-5-(trifluoromethoxy)cyclohexa-1,3-dien-1-yl]-3-(1,3-dioxoisoindol-2-yl)-2-(4-methylsulfonylphenyl)propanamide (PubChem CID 175185920) has the molecular formula C31H23Cl2F3N2O6S and a molecular weight of 679.50 g/mol. Its IUPAC name is N-[3,5-dichloro-4-phenyl-5-(trifluoromethoxy)cyclohexa-1,3-dien-1-yl]-3-(1,3-dioxoisoindol-2-yl)-2-(4-methylsulfonylphenyl)propanamide.
| Compound Name | N-[3,5-dichloro-4-phenyl-5-(trifluoromethoxy)cyclohexa-1,3-dien-1-yl]-3-(1,3-dioxoisoindol-2-yl)-2-(4-methylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 175185920 |
| Molecular Formula | C31H23Cl2F3N2O6S |
| Molecular Weight | 679.50 g/mol |
| Exact Mass | 678.06 |
| IUPAC Name | N-[3,5-dichloro-4-phenyl-5-(trifluoromethoxy)cyclohexa-1,3-dien-1-yl]-3-(1,3-dioxoisoindol-2-yl)-2-(4-methylsulfonylphenyl)propanamide |
| SMILES | CS(=O)(=O)c1ccc(C(CN2C(=O)c3ccccc3C2=O)C(=O)NC2=CC(Cl)=C(c3ccccc3)C(Cl)(OC(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C31H23Cl2F3N2O6S/c1-45(42,43)21-13-11-18(12-14-21)24(17-38-28(40)22-9-5-6-10-23(22)29(38)41)27(39)37-20-15-25(32)26(19-7-3-2-4-8-19)30(33,16-20)44-31(34,35)36/h2-15,24H,16-17H2,1H3,(H,37,39) |
| InChIKey | KZUPLCCHPHARNL-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.50 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|