C14H14N2O4 — CID 66809803
dimethyl 2-pyridin-2-yl-3H-pyridine-4,4-dicarboxylate (PubChem CID 66809803) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is dimethyl 2-pyridin-2-yl-3H-pyridine-4,4-dicarboxylate.
| Compound Name | dimethyl 2-pyridin-2-yl-3H-pyridine-4,4-dicarboxylate |
|---|---|
| PubChem CID | 66809803 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | dimethyl 2-pyridin-2-yl-3H-pyridine-4,4-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C=CN=C(c2ccccn2)C1 |
| InChI | InChI=1S/C14H14N2O4/c1-19-12(17)14(13(18)20-2)6-8-16-11(9-14)10-5-3-4-7-15-10/h3-8H,9H2,1-2H3 |
| InChIKey | HCDXMJDDZLSJKE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 77.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|