C15H13BrO4 — CID 175214208
4-(2-bromophenyl)-1-methoxycarbonylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 175214208) has the molecular formula C15H13BrO4 and a molecular weight of 337.17 g/mol. Its IUPAC name is 4-(2-bromophenyl)-1-methoxycarbonylcyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 4-(2-bromophenyl)-1-methoxycarbonylcyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 175214208 |
| Molecular Formula | C15H13BrO4 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | 4-(2-bromophenyl)-1-methoxycarbonylcyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | COC(=O)C1(C(=O)O)C=CC(c2ccccc2Br)=CC1 |
| InChI | InChI=1S/C15H13BrO4/c1-20-14(19)15(13(17)18)8-6-10(7-9-15)11-4-2-3-5-12(11)16/h2-8H,9H2,1H3,(H,17,18) |
| InChIKey | UAWWJVMHTBKEIB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|