C11H10BrN — CID 173278953
4-(2-bromophenyl)-1,2-dihydropyridine (PubChem CID 173278953) has the molecular formula C11H10BrN and a molecular weight of 236.11 g/mol. Its IUPAC name is 4-(2-bromophenyl)-1,2-dihydropyridine.
| Compound Name | 4-(2-bromophenyl)-1,2-dihydropyridine |
|---|---|
| PubChem CID | 173278953 |
| Molecular Formula | C11H10BrN |
| Molecular Weight | 236.11 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | 4-(2-bromophenyl)-1,2-dihydropyridine |
| SMILES | Brc1ccccc1C1=CCNC=C1 |
| InChI | InChI=1S/C11H10BrN/c12-11-4-2-1-3-10(11)9-5-7-13-8-6-9/h1-7,13H,8H2 |
| InChIKey | OLRJQSYAEKJAGM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.11 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |