C22H21O2P — CID 174906691
1-(3,4-dimethylphenyl)-2-diphenylphosphorylethanone (PubChem CID 174906691) has the molecular formula C22H21O2P and a molecular weight of 348.38 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-diphenylphosphorylethanone.
| Compound Name | 1-(3,4-dimethylphenyl)-2-diphenylphosphorylethanone |
|---|---|
| PubChem CID | 174906691 |
| Molecular Formula | C22H21O2P |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-diphenylphosphorylethanone |
| SMILES | Cc1ccc(C(=O)CP(=O)(c2ccccc2)c2ccccc2)cc1C |
| InChI | InChI=1S/C22H21O2P/c1-17-13-14-19(15-18(17)2)22(23)16-25(24,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-15H,16H2,1-2H3 |
| InChIKey | CBSABUALYKYCMM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|