C22H25NO4 — CID 55993616
methyl 2-[benzyl-[4-(3,4-dimethylphenyl)-4-oxobutanoyl]amino]acetate (PubChem CID 55993616) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is methyl 2-[benzyl-[4-(3,4-dimethylphenyl)-4-oxobutanoyl]amino]acetate.
| Compound Name | methyl 2-[benzyl-[4-(3,4-dimethylphenyl)-4-oxobutanoyl]amino]acetate |
|---|---|
| PubChem CID | 55993616 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | methyl 2-[benzyl-[4-(3,4-dimethylphenyl)-4-oxobutanoyl]amino]acetate |
| SMILES | COC(=O)CN(Cc1ccccc1)C(=O)CCC(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C22H25NO4/c1-16-9-10-19(13-17(16)2)20(24)11-12-21(25)23(15-22(26)27-3)14-18-7-5-4-6-8-18/h4-10,13H,11-12,14-15H2,1-3H3 |
| InChIKey | MPXBHAGIEYPGBI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |