C21H23NO4 — CID 26263009
benzyl 2-[[4-(3,4-dimethylphenyl)-4-oxobutanoyl]amino]acetate (PubChem CID 26263009) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is benzyl 2-[[4-(3,4-dimethylphenyl)-4-oxobutanoyl]amino]acetate.
| Compound Name | benzyl 2-[[4-(3,4-dimethylphenyl)-4-oxobutanoyl]amino]acetate |
|---|---|
| PubChem CID | 26263009 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | benzyl 2-[[4-(3,4-dimethylphenyl)-4-oxobutanoyl]amino]acetate |
| SMILES | Cc1ccc(C(=O)CCC(=O)NCC(=O)OCc2ccccc2)cc1C |
| InChI | InChI=1S/C21H23NO4/c1-15-8-9-18(12-16(15)2)19(23)10-11-20(24)22-13-21(25)26-14-17-6-4-3-5-7-17/h3-9,12H,10-11,13-14H2,1-2H3,(H,22,24) |
| InChIKey | SWGZJFHANRYDLN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |