C21H26N2O7 — CID 158057787
benzyl 2-[[6-(2,5-dioxohexylamino)-4,6-dioxohexanoyl]amino]acetate (PubChem CID 158057787) has the molecular formula C21H26N2O7 and a molecular weight of 418.45 g/mol. Its IUPAC name is benzyl 2-[[6-(2,5-dioxohexylamino)-4,6-dioxohexanoyl]amino]acetate.
| Compound Name | benzyl 2-[[6-(2,5-dioxohexylamino)-4,6-dioxohexanoyl]amino]acetate |
|---|---|
| PubChem CID | 158057787 |
| Molecular Formula | C21H26N2O7 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | benzyl 2-[[6-(2,5-dioxohexylamino)-4,6-dioxohexanoyl]amino]acetate |
| SMILES | CC(=O)CCC(=O)CNC(=O)CC(=O)CCC(=O)NCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H26N2O7/c1-15(24)7-8-18(26)12-22-20(28)11-17(25)9-10-19(27)23-13-21(29)30-14-16-5-3-2-4-6-16/h2-6H,7-14H2,1H3,(H,22,28)(H,23,27) |
| InChIKey | BJDUWKWWLRNCNG-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 135.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|