C22H25NO6 — CID 163225005
ethyl 4-[4-oxo-4-[(2-oxo-2-phenylmethoxyethyl)amino]butoxy]benzoate (PubChem CID 163225005) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is ethyl 4-[4-oxo-4-[(2-oxo-2-phenylmethoxyethyl)amino]butoxy]benzoate.
| Compound Name | ethyl 4-[4-oxo-4-[(2-oxo-2-phenylmethoxyethyl)amino]butoxy]benzoate |
|---|---|
| PubChem CID | 163225005 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | ethyl 4-[4-oxo-4-[(2-oxo-2-phenylmethoxyethyl)amino]butoxy]benzoate |
| SMILES | CCOC(=O)c1ccc(OCCCC(=O)NCC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H25NO6/c1-2-27-22(26)18-10-12-19(13-11-18)28-14-6-9-20(24)23-15-21(25)29-16-17-7-4-3-5-8-17/h3-5,7-8,10-13H,2,6,9,14-16H2,1H3,(H,23,24) |
| InChIKey | VDWGVZRWMUOMJX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|