methyl 2-[benzyl-[3-(propan-2-ylamino)propanoyl]amino]acetate

C16H24N2O3 — CID 60946952

IUPACmethyl 2-[benzyl-[3-(propan-2-ylamino)propanoyl]amino]acetate
SMILESCOC(=O)CN(Cc1ccccc1)C(=O)CCNC(C)C
InChIInChI=1S/C16H24N2O3/c1-13(2)17-10-9-15(19)18(12-16(20)21-3)11-14-7-5-4-6-8-14/h4-8,13,17H,9-12H2,1-3H3
InChIKeyIROKUPYDYUOBPE-UHFFFAOYSA-N
MW292.38 g/mol
LogP1.58
Rot. Bonds8

About methyl 2-[benzyl-[3-(propan-2-ylamino)propanoyl]amino]acetate

methyl 2-[benzyl-[3-(propan-2-ylamino)propanoyl]amino]acetate (PubChem CID 60946952) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is methyl 2-[benzyl-[3-(propan-2-ylamino)propanoyl]amino]acetate.

Molecular Properties

Compound Namemethyl 2-[benzyl-[3-(propan-2-ylamino)propanoyl]amino]acetate
PubChem CID60946952
Molecular FormulaC16H24N2O3
Molecular Weight292.38 g/mol
Exact Mass292.18
IUPAC Namemethyl 2-[benzyl-[3-(propan-2-ylamino)propanoyl]amino]acetate
SMILESCOC(=O)CN(Cc1ccccc1)C(=O)CCNC(C)C
InChIInChI=1S/C16H24N2O3/c1-13(2)17-10-9-15(19)18(12-16(20)21-3)11-14-7-5-4-6-8-14/h4-8,13,17H,9-12H2,1-3H3
InChIKeyIROKUPYDYUOBPE-UHFFFAOYSA-N
XLogP1.58
TPSA58.64 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.38
LogP ≤ 51.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2-[benzyl-[3-(propan-2-ylamino)propanoyl]amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[benzyl-[3-(propan-2-ylamino)propanoyl]amino]acetate?
The IUPAC name of methyl 2-[benzyl-[3-(propan-2-ylamino)propanoyl]amino]acetate (CID 60946952) is methyl 2-[benzyl-[3-(propan-2-ylamino)propanoyl]amino]acetate.
What is the SMILES notation for methyl 2-[benzyl-[3-(propan-2-ylamino)propanoyl]amino]acetate?
The canonical SMILES for methyl 2-[benzyl-[3-(propan-2-ylamino)propanoyl]amino]acetate is COC(=O)CN(Cc1ccccc1)C(=O)CCNC(C)C.
What is the InChIKey of methyl 2-[benzyl-[3-(propan-2-ylamino)propanoyl]amino]acetate?
The InChIKey is IROKUPYDYUOBPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O3/c1-13(2)17-10-9-15(19)18(12-16(20)21-3)11-14-7-5-4-6-8-14/h4-8,13,17H,9-12H2,1-3H3.
What are the key properties of methyl 2-[benzyl-[3-(propan-2-ylamino)propanoyl]amino]acetate?
methyl 2-[benzyl-[3-(propan-2-ylamino)propanoyl]amino]acetate has a molecular weight of 292.38 g/mol, XLogP of 1.58, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[benzyl-[3-(propan-2-ylamino)propanoyl]amino]acetate is sourced from PubChem (CID 60946952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).