C20H22ClN3O4 — CID 55803002
methyl 2-[(4-chlorophenyl)methyl-[3-(phenylcarbamoylamino)propanoyl]amino]acetate (PubChem CID 55803002) has the molecular formula C20H22ClN3O4 and a molecular weight of 403.87 g/mol. Its IUPAC name is methyl 2-[(4-chlorophenyl)methyl-[3-(phenylcarbamoylamino)propanoyl]amino]acetate.
| Compound Name | methyl 2-[(4-chlorophenyl)methyl-[3-(phenylcarbamoylamino)propanoyl]amino]acetate |
|---|---|
| PubChem CID | 55803002 |
| Molecular Formula | C20H22ClN3O4 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | methyl 2-[(4-chlorophenyl)methyl-[3-(phenylcarbamoylamino)propanoyl]amino]acetate |
| SMILES | COC(=O)CN(Cc1ccc(Cl)cc1)C(=O)CCNC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H22ClN3O4/c1-28-19(26)14-24(13-15-7-9-16(21)10-8-15)18(25)11-12-22-20(27)23-17-5-3-2-4-6-17/h2-10H,11-14H2,1H3,(H2,22,23,27) |
| InChIKey | CDYIFSMIIBNAPF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |