C17H14ClF2NO3 — CID 55802942
methyl 2-[(4-chlorophenyl)methyl-(3,5-difluorobenzoyl)amino]acetate (PubChem CID 55802942) has the molecular formula C17H14ClF2NO3 and a molecular weight of 353.75 g/mol. Its IUPAC name is methyl 2-[(4-chlorophenyl)methyl-(3,5-difluorobenzoyl)amino]acetate.
| Compound Name | methyl 2-[(4-chlorophenyl)methyl-(3,5-difluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 55802942 |
| Molecular Formula | C17H14ClF2NO3 |
| Molecular Weight | 353.75 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | methyl 2-[(4-chlorophenyl)methyl-(3,5-difluorobenzoyl)amino]acetate |
| SMILES | COC(=O)CN(Cc1ccc(Cl)cc1)C(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H14ClF2NO3/c1-24-16(22)10-21(9-11-2-4-13(18)5-3-11)17(23)12-6-14(19)8-15(20)7-12/h2-8H,9-10H2,1H3 |
| InChIKey | CZFWYMFLIPBEJW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.75 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |