C16H13ClN2O3S — CID 71859445
methyl 2-[(4-chlorophenyl)methyl-(4-cyanothiophene-2-carbonyl)amino]acetate (PubChem CID 71859445) has the molecular formula C16H13ClN2O3S and a molecular weight of 348.81 g/mol. Its IUPAC name is methyl 2-[(4-chlorophenyl)methyl-(4-cyanothiophene-2-carbonyl)amino]acetate.
| Compound Name | methyl 2-[(4-chlorophenyl)methyl-(4-cyanothiophene-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 71859445 |
| Molecular Formula | C16H13ClN2O3S |
| Molecular Weight | 348.81 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | methyl 2-[(4-chlorophenyl)methyl-(4-cyanothiophene-2-carbonyl)amino]acetate |
| SMILES | COC(=O)CN(Cc1ccc(Cl)cc1)C(=O)c1cc(C#N)cs1 |
| InChI | InChI=1S/C16H13ClN2O3S/c1-22-15(20)9-19(8-11-2-4-13(17)5-3-11)16(21)14-6-12(7-18)10-23-14/h2-6,10H,8-9H2,1H3 |
| InChIKey | ALJFHFHMIHKCRM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.81 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |