C13H17N3O4 — CID 43409770
methyl 2-[methyl-[2-(phenylcarbamoylamino)acetyl]amino]acetate (PubChem CID 43409770) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is methyl 2-[methyl-[2-(phenylcarbamoylamino)acetyl]amino]acetate.
| Compound Name | methyl 2-[methyl-[2-(phenylcarbamoylamino)acetyl]amino]acetate |
|---|---|
| PubChem CID | 43409770 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | methyl 2-[methyl-[2-(phenylcarbamoylamino)acetyl]amino]acetate |
| SMILES | COC(=O)CN(C)C(=O)CNC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C13H17N3O4/c1-16(9-12(18)20-2)11(17)8-14-13(19)15-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3,(H2,14,15,19) |
| InChIKey | RESIKTCNHJZBNO-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |