C14H19N3O4 — CID 43359989
4-[methyl-[2-(phenylcarbamoylamino)acetyl]amino]butanoic acid (PubChem CID 43359989) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is 4-[methyl-[2-(phenylcarbamoylamino)acetyl]amino]butanoic acid.
| Compound Name | 4-[methyl-[2-(phenylcarbamoylamino)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43359989 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 4-[methyl-[2-(phenylcarbamoylamino)acetyl]amino]butanoic acid |
| SMILES | CN(CCCC(=O)O)C(=O)CNC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C14H19N3O4/c1-17(9-5-8-13(19)20)12(18)10-15-14(21)16-11-6-3-2-4-7-11/h2-4,6-7H,5,8-10H2,1H3,(H,19,20)(H2,15,16,21) |
| InChIKey | CSRAFKSPKHYXNZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |