C38H47NOSi — CID 24949039
(E,2S,5R)-5-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-N-tritylhex-3-en-2-amine (PubChem CID 24949039) has the molecular formula C38H47NOSi and a molecular weight of 561.89 g/mol. Its IUPAC name is (E,2S,5R)-5-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-N-tritylhex-3-en-2-amine.
| Compound Name | (E,2S,5R)-5-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-N-tritylhex-3-en-2-amine |
|---|---|
| PubChem CID | 24949039 |
| Molecular Formula | C38H47NOSi |
| Molecular Weight | 561.89 g/mol |
| Exact Mass | 561.34 |
| IUPAC Name | (E,2S,5R)-5-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-N-tritylhex-3-en-2-amine |
| SMILES | C[C@@H](/C=C/[C@H](CO[Si](C)(C)C(C)(C)C)Cc1ccccc1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H47NOSi/c1-31(27-28-33(29-32-19-11-7-12-20-32)30-40-41(5,6)37(2,3)4)39-38(34-21-13-8-14-22-34,35-23-15-9-16-24-35)36-25-17-10-18-26-36/h7-28,31,33,39H,29-30H2,1-6H3/b28-27+/t31-,33-/m0/s1 |
| InChIKey | OPBINGMSYCZMRQ-PXZSFKDGSA-N |
| XLogP | 9.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.89 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|