C34H47NO3Si — CID 22949424
tert-butyl N-[(E)-5-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-2-ylhex-3-en-2-yl]carbamate (PubChem CID 22949424) has the molecular formula C34H47NO3Si and a molecular weight of 545.84 g/mol. Its IUPAC name is tert-butyl N-[(E)-5-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-2-ylhex-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E)-5-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-2-ylhex-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 22949424 |
| Molecular Formula | C34H47NO3Si |
| Molecular Weight | 545.84 g/mol |
| Exact Mass | 545.33 |
| IUPAC Name | tert-butyl N-[(E)-5-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-2-ylhex-3-en-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(/C=C/C(CO[Si](C)(C)C(C)(C)C)Cc1ccccc1)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C34H47NO3Si/c1-33(2,3)38-32(36)35-31(24-27-18-20-29-16-12-13-17-30(29)23-27)21-19-28(22-26-14-10-9-11-15-26)25-37-39(7,8)34(4,5)6/h9-21,23,28,31H,22,24-25H2,1-8H3,(H,35,36)/b21-19+ |
| InChIKey | AAELQGVAEZPDIE-XUTLUUPISA-N |
| XLogP | 8.71 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.84 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|