C30H39NO3Si — CID 142626458
[(E,2R)-5-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-2-ylhex-3-en-2-yl]carbamic acid (PubChem CID 142626458) has the molecular formula C30H39NO3Si and a molecular weight of 489.73 g/mol. Its IUPAC name is [(E,2R)-5-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-2-ylhex-3-en-2-yl]carbamic acid.
| Compound Name | [(E,2R)-5-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-2-ylhex-3-en-2-yl]carbamic acid |
|---|---|
| PubChem CID | 142626458 |
| Molecular Formula | C30H39NO3Si |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | [(E,2R)-5-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-2-ylhex-3-en-2-yl]carbamic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCC(/C=C/[C@@H](Cc1ccc2ccccc2c1)NC(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C30H39NO3Si/c1-30(2,3)35(4,5)34-22-25(19-23-11-7-6-8-12-23)16-18-28(31-29(32)33)21-24-15-17-26-13-9-10-14-27(26)20-24/h6-18,20,25,28,31H,19,21-22H2,1-5H3,(H,32,33)/b18-16+/t25?,28-/m0/s1 |
| InChIKey | OBOLCTZXRMFFQD-BDSJWDMDSA-N |
| XLogP | 7.46 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|