C29H34N2O2 — CID 22949382
N-[(E)-5-benzyl-6-hydroxy-1-naphthalen-2-ylhex-3-en-2-yl]piperidine-3-carboxamide (PubChem CID 22949382) has the molecular formula C29H34N2O2 and a molecular weight of 442.60 g/mol. Its IUPAC name is N-[(E)-5-benzyl-6-hydroxy-1-naphthalen-2-ylhex-3-en-2-yl]piperidine-3-carboxamide.
| Compound Name | N-[(E)-5-benzyl-6-hydroxy-1-naphthalen-2-ylhex-3-en-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 22949382 |
| Molecular Formula | C29H34N2O2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | N-[(E)-5-benzyl-6-hydroxy-1-naphthalen-2-ylhex-3-en-2-yl]piperidine-3-carboxamide |
| SMILES | O=C(NC(/C=C/C(CO)Cc1ccccc1)Cc1ccc2ccccc2c1)C1CCCNC1 |
| InChI | InChI=1S/C29H34N2O2/c32-21-24(17-22-7-2-1-3-8-22)13-15-28(31-29(33)27-11-6-16-30-20-27)19-23-12-14-25-9-4-5-10-26(25)18-23/h1-5,7-10,12-15,18,24,27-28,30,32H,6,11,16-17,19-21H2,(H,31,33)/b15-13+ |
| InChIKey | NJXSTJMWHBPLCA-FYWRMAATSA-N |
| XLogP | 4.27 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|