C32H38O3Si — CID 153297014
[5-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-2-ylpentan-2-yl] naphthalene-2-carboxylate (PubChem CID 153297014) has the molecular formula C32H38O3Si and a molecular weight of 498.74 g/mol. Its IUPAC name is [5-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-2-ylpentan-2-yl] naphthalene-2-carboxylate.
| Compound Name | [5-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-2-ylpentan-2-yl] naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 153297014 |
| Molecular Formula | C32H38O3Si |
| Molecular Weight | 498.74 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | [5-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-2-ylpentan-2-yl] naphthalene-2-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC(Cc1ccc2ccccc2c1)OC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C32H38O3Si/c1-32(2,3)36(4,5)34-20-10-15-30(22-24-16-17-25-11-6-8-13-27(25)21-24)35-31(33)29-19-18-26-12-7-9-14-28(26)23-29/h6-9,11-14,16-19,21,23,30H,10,15,20,22H2,1-5H3 |
| InChIKey | GJMSQXNANZSSIN-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.74 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|