C36H56O5Si — CID 10746096
[(3R,4S,7R,8R,9S)-12-[tert-butyl(dimethyl)silyl]oxy-8-[(4-methoxyphenyl)methoxy]-3,7,9-trimethyldodec-1-en-4-yl] benzoate (PubChem CID 10746096) has the molecular formula C36H56O5Si and a molecular weight of 596.93 g/mol. Its IUPAC name is [(3R,4S,7R,8R,9S)-12-[tert-butyl(dimethyl)silyl]oxy-8-[(4-methoxyphenyl)methoxy]-3,7,9-trimethyldodec-1-en-4-yl] benzoate.
| Compound Name | [(3R,4S,7R,8R,9S)-12-[tert-butyl(dimethyl)silyl]oxy-8-[(4-methoxyphenyl)methoxy]-3,7,9-trimethyldodec-1-en-4-yl] benzoate |
|---|---|
| PubChem CID | 10746096 |
| Molecular Formula | C36H56O5Si |
| Molecular Weight | 596.93 g/mol |
| Exact Mass | 596.39 |
| IUPAC Name | [(3R,4S,7R,8R,9S)-12-[tert-butyl(dimethyl)silyl]oxy-8-[(4-methoxyphenyl)methoxy]-3,7,9-trimethyldodec-1-en-4-yl] benzoate |
| SMILES | C=C[C@@H](C)[C@H](CC[C@@H](C)[C@H](OCc1ccc(OC)cc1)[C@@H](C)CCCO[Si](C)(C)C(C)(C)C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C36H56O5Si/c1-11-27(2)33(41-35(37)31-17-13-12-14-18-31)24-19-29(4)34(39-26-30-20-22-32(38-8)23-21-30)28(3)16-15-25-40-42(9,10)36(5,6)7/h11-14,17-18,20-23,27-29,33-34H,1,15-16,19,24-26H2,2-10H3/t27-,28+,29-,33+,34-/m1/s1 |
| InChIKey | WIIWQFZTIKOBLZ-XYHMQKDISA-N |
| XLogP | 9.48 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.93 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|