C47H67NO8Si — CID 134878906
[(3S,6S,7R,13S,14S,15R)-18-[tert-butyl(diphenyl)silyl]oxy-14-(methoxymethoxy)-3,7,13,15-tetramethyl-10-oxooctadec-1-en-6-yl] 4-nitrobenzoate (PubChem CID 134878906) has the molecular formula C47H67NO8Si and a molecular weight of 802.14 g/mol. Its IUPAC name is [(3S,6S,7R,13S,14S,15R)-18-[tert-butyl(diphenyl)silyl]oxy-14-(methoxymethoxy)-3,7,13,15-tetramethyl-10-oxooctadec-1-en-6-yl] 4-nitrobenzoate.
| Compound Name | [(3S,6S,7R,13S,14S,15R)-18-[tert-butyl(diphenyl)silyl]oxy-14-(methoxymethoxy)-3,7,13,15-tetramethyl-10-oxooctadec-1-en-6-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 134878906 |
| Molecular Formula | C47H67NO8Si |
| Molecular Weight | 802.14 g/mol |
| Exact Mass | 801.46 |
| IUPAC Name | [(3S,6S,7R,13S,14S,15R)-18-[tert-butyl(diphenyl)silyl]oxy-14-(methoxymethoxy)-3,7,13,15-tetramethyl-10-oxooctadec-1-en-6-yl] 4-nitrobenzoate |
| SMILES | C=C[C@@H](C)CC[C@H](OC(=O)c1ccc([N+](=O)[O-])cc1)[C@H](C)CCC(=O)CC[C@H](C)[C@@H](OCOC)[C@H](C)CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C47H67NO8Si/c1-10-35(2)23-32-44(56-46(50)39-26-28-40(29-27-39)48(51)52)36(3)24-30-41(49)31-25-38(5)45(54-34-53-9)37(4)18-17-33-55-57(47(6,7)8,42-19-13-11-14-20-42)43-21-15-12-16-22-43/h10-16,19-22,26-29,35-38,44-45H,1,17-18,23-25,30-34H2,2-9H3/t35-,36-,37-,38+,44+,45+/m1/s1 |
| InChIKey | TUKAWUVHHHCHDC-YHQHDQDMSA-N |
| XLogP | 10.11 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.14 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|