C41H54N2O6Si — CID 177401256
tert-butyl N-[(1S)-1-[(2R)-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-oxo-2H-furan-2-yl]-4-oxo-4-(tritylamino)butyl]carbamate (PubChem CID 177401256) has the molecular formula C41H54N2O6Si and a molecular weight of 698.98 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[(2R)-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-oxo-2H-furan-2-yl]-4-oxo-4-(tritylamino)butyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[(2R)-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-oxo-2H-furan-2-yl]-4-oxo-4-(tritylamino)butyl]carbamate |
|---|---|
| PubChem CID | 177401256 |
| Molecular Formula | C41H54N2O6Si |
| Molecular Weight | 698.98 g/mol |
| Exact Mass | 698.38 |
| IUPAC Name | tert-butyl N-[(1S)-1-[(2R)-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-5-oxo-2H-furan-2-yl]-4-oxo-4-(tritylamino)butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@H]1C=C(CCCO[Si](C)(C)C(C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C41H54N2O6Si/c1-39(2,3)49-38(46)42-34(35-29-30(37(45)48-35)19-18-28-47-50(7,8)40(4,5)6)26-27-36(44)43-41(31-20-12-9-13-21-31,32-22-14-10-15-23-32)33-24-16-11-17-25-33/h9-17,20-25,29,34-35H,18-19,26-28H2,1-8H3,(H,42,46)(H,43,44)/t34-,35+/m0/s1 |
| InChIKey | WKHSNOURBYMNDW-OIDHKYIRSA-N |
| XLogP | 8.42 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.98 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|