C39H42N2O5 — CID 142696596
2-phenylethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxo-7-(tritylamino)hept-2-enoate (PubChem CID 142696596) has the molecular formula C39H42N2O5 and a molecular weight of 618.77 g/mol. Its IUPAC name is 2-phenylethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxo-7-(tritylamino)hept-2-enoate.
| Compound Name | 2-phenylethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxo-7-(tritylamino)hept-2-enoate |
|---|---|
| PubChem CID | 142696596 |
| Molecular Formula | C39H42N2O5 |
| Molecular Weight | 618.77 g/mol |
| Exact Mass | 618.31 |
| IUPAC Name | 2-phenylethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxo-7-(tritylamino)hept-2-enoate |
| SMILES | CC(C)(C)OC(=O)N[C@H](/C=C/C(=O)OCCc1ccccc1)CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H42N2O5/c1-38(2,3)46-37(44)40-34(25-27-36(43)45-29-28-30-16-8-4-9-17-30)24-26-35(42)41-39(31-18-10-5-11-19-31,32-20-12-6-13-21-32)33-22-14-7-15-23-33/h4-23,25,27,34H,24,26,28-29H2,1-3H3,(H,40,44)(H,41,42)/b27-25+/t34-/m0/s1 |
| InChIKey | VPZNMFGSMXEGDE-KLFOJWPUSA-N |
| XLogP | 7.11 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.77 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|