C16H39NO2Si2 — CID 71418024
1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-N-methylpropan-2-amine (PubChem CID 71418024) has the molecular formula C16H39NO2Si2 and a molecular weight of 333.67 g/mol. Its IUPAC name is 1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-N-methylpropan-2-amine.
| Compound Name | 1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 71418024 |
| Molecular Formula | C16H39NO2Si2 |
| Molecular Weight | 333.67 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | 1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-N-methylpropan-2-amine |
| SMILES | CNC(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H39NO2Si2/c1-15(2,3)20(8,9)18-12-14(17-7)13-19-21(10,11)16(4,5)6/h14,17H,12-13H2,1-11H3 |
| InChIKey | UBYXXPLWZVYCMU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.67 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|