C22H48O4Si2 — CID 10884543
[(3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-3-tri(propan-2-yl)silyloxybutyl] acetate (PubChem CID 10884543) has the molecular formula C22H48O4Si2 and a molecular weight of 432.79 g/mol. Its IUPAC name is [(3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-3-tri(propan-2-yl)silyloxybutyl] acetate.
| Compound Name | [(3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-3-tri(propan-2-yl)silyloxybutyl] acetate |
|---|---|
| PubChem CID | 10884543 |
| Molecular Formula | C22H48O4Si2 |
| Molecular Weight | 432.79 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | [(3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-3-tri(propan-2-yl)silyloxybutyl] acetate |
| SMILES | CC(=O)OCC[C@](C)(CO[Si](C)(C)C(C)(C)C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H48O4Si2/c1-17(2)28(18(3)4,19(5)6)26-22(11,14-15-24-20(7)23)16-25-27(12,13)21(8,9)10/h17-19H,14-16H2,1-13H3/t22-/m1/s1 |
| InChIKey | UOBXYGRXZBKNIF-JOCHJYFZSA-N |
| XLogP | 6.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.79 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|