C27H61NO4Si3 — CID 173390415
2-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]propan-2-yl]pentanamide (PubChem CID 173390415) has the molecular formula C27H61NO4Si3 and a molecular weight of 548.05 g/mol. Its IUPAC name is 2-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]propan-2-yl]pentanamide.
| Compound Name | 2-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]propan-2-yl]pentanamide |
|---|---|
| PubChem CID | 173390415 |
| Molecular Formula | C27H61NO4Si3 |
| Molecular Weight | 548.05 g/mol |
| Exact Mass | 547.39 |
| IUPAC Name | 2-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]propan-2-yl]pentanamide |
| SMILES | CCCC(C(N)=O)C(CO[Si](C)(C)C(C)(C)C)(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H61NO4Si3/c1-17-18-22(23(28)29)27(19-30-33(11,12)24(2,3)4,20-31-34(13,14)25(5,6)7)21-32-35(15,16)26(8,9)10/h22H,17-21H2,1-16H3,(H2,28,29) |
| InChIKey | RNDIWFJIJVAYBR-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.05 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|