C17H36N2O5Si — CID 59656752
tert-butyl N-[3-[tert-butyl(dimethyl)silyl]oxy-1-[methoxy(methyl)amino]-1-oxopropan-2-yl]-N-methylcarbamate (PubChem CID 59656752) has the molecular formula C17H36N2O5Si and a molecular weight of 376.57 g/mol. Its IUPAC name is tert-butyl N-[3-[tert-butyl(dimethyl)silyl]oxy-1-[methoxy(methyl)amino]-1-oxopropan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[tert-butyl(dimethyl)silyl]oxy-1-[methoxy(methyl)amino]-1-oxopropan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 59656752 |
| Molecular Formula | C17H36N2O5Si |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | tert-butyl N-[3-[tert-butyl(dimethyl)silyl]oxy-1-[methoxy(methyl)amino]-1-oxopropan-2-yl]-N-methylcarbamate |
| SMILES | CON(C)C(=O)C(CO[Si](C)(C)C(C)(C)C)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H36N2O5Si/c1-16(2,3)24-15(21)18(7)13(14(20)19(8)22-9)12-23-25(10,11)17(4,5)6/h13H,12H2,1-11H3 |
| InChIKey | YWZSFSKFBBYQJB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|