C20H40N2O4Si — CID 59271881
tert-butyl N-[5-[tert-butyl(dimethyl)silyl]oxy-1-cyano-4-methoxy-4-methylpentyl]-N-methylcarbamate (PubChem CID 59271881) has the molecular formula C20H40N2O4Si and a molecular weight of 400.64 g/mol. Its IUPAC name is tert-butyl N-[5-[tert-butyl(dimethyl)silyl]oxy-1-cyano-4-methoxy-4-methylpentyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[5-[tert-butyl(dimethyl)silyl]oxy-1-cyano-4-methoxy-4-methylpentyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 59271881 |
| Molecular Formula | C20H40N2O4Si |
| Molecular Weight | 400.64 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | tert-butyl N-[5-[tert-butyl(dimethyl)silyl]oxy-1-cyano-4-methoxy-4-methylpentyl]-N-methylcarbamate |
| SMILES | COC(C)(CCC(C#N)N(C)C(=O)OC(C)(C)C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40N2O4Si/c1-18(2,3)26-17(23)22(8)16(14-21)12-13-20(7,24-9)15-25-27(10,11)19(4,5)6/h16H,12-13,15H2,1-11H3 |
| InChIKey | YOGSYQJRZIYYSP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.64 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|