C19H39NO5Si — CID 90700845
3-[tert-butyl(dimethyl)silyl]oxy-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]heptanoic acid (PubChem CID 90700845) has the molecular formula C19H39NO5Si and a molecular weight of 389.61 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]heptanoic acid.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 90700845 |
| Molecular Formula | C19H39NO5Si |
| Molecular Weight | 389.61 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]heptanoic acid |
| SMILES | CCCC(C(CC(=O)O)O[Si](C)(C)C(C)(C)C)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H39NO5Si/c1-11-12-14(20(8)17(23)24-18(2,3)4)15(13-16(21)22)25-26(9,10)19(5,6)7/h14-15H,11-13H2,1-10H3,(H,21,22) |
| InChIKey | NLWPKRRJISIXLY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.61 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|