C22H39NO3Si — CID 139793833
tert-butyl N-benzyl-N-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]carbamate (PubChem CID 139793833) has the molecular formula C22H39NO3Si and a molecular weight of 393.64 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 139793833 |
| Molecular Formula | C22H39NO3Si |
| Molecular Weight | 393.64 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | tert-butyl N-benzyl-N-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccccc1)C(C)(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H39NO3Si/c1-20(2,3)26-19(24)23(16-18-14-12-11-13-15-18)22(7,8)17-25-27(9,10)21(4,5)6/h11-15H,16-17H2,1-10H3 |
| InChIKey | CUPBMSFKGNLAOU-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.64 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|