C32H55NO5Si — CID 10698140
benzyl (Z)-10-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-10-methylundec-5-enoate (PubChem CID 10698140) has the molecular formula C32H55NO5Si and a molecular weight of 561.88 g/mol. Its IUPAC name is benzyl (Z)-10-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-10-methylundec-5-enoate.
| Compound Name | benzyl (Z)-10-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-10-methylundec-5-enoate |
|---|---|
| PubChem CID | 10698140 |
| Molecular Formula | C32H55NO5Si |
| Molecular Weight | 561.88 g/mol |
| Exact Mass | 561.38 |
| IUPAC Name | benzyl (Z)-10-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-10-methylundec-5-enoate |
| SMILES | CC(C)(C)OC(=O)N(CCO[Si](C)(C)C(C)(C)C)C(C)(C)CCC/C=C\CCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H55NO5Si/c1-30(2,3)38-29(35)33(24-25-37-39(9,10)31(4,5)6)32(7,8)23-19-14-12-11-13-18-22-28(34)36-26-27-20-16-15-17-21-27/h11-12,15-17,20-21H,13-14,18-19,22-26H2,1-10H3/b12-11- |
| InChIKey | OTFNAQGKEVHEIN-QXMHVHEDSA-N |
| XLogP | 8.66 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.88 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|