C36H55NO6Si — CID 134937416
tert-butyl N-benzyl-N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-2-[(3,4-dimethylphenyl)methoxymethyl]-5-(2-methoxyethoxy)pent-3-yn-2-yl]carbamate (PubChem CID 134937416) has the molecular formula C36H55NO6Si and a molecular weight of 625.92 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-2-[(3,4-dimethylphenyl)methoxymethyl]-5-(2-methoxyethoxy)pent-3-yn-2-yl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-2-[(3,4-dimethylphenyl)methoxymethyl]-5-(2-methoxyethoxy)pent-3-yn-2-yl]carbamate |
|---|---|
| PubChem CID | 134937416 |
| Molecular Formula | C36H55NO6Si |
| Molecular Weight | 625.92 g/mol |
| Exact Mass | 625.38 |
| IUPAC Name | tert-butyl N-benzyl-N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-2-[(3,4-dimethylphenyl)methoxymethyl]-5-(2-methoxyethoxy)pent-3-yn-2-yl]carbamate |
| SMILES | COCCOCC#C[C@](COCc1ccc(C)c(C)c1)(CO[Si](C)(C)C(C)(C)C)N(Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H55NO6Si/c1-29-18-19-32(24-30(29)2)26-41-27-36(20-15-21-40-23-22-39-9,28-42-44(10,11)35(6,7)8)37(33(38)43-34(3,4)5)25-31-16-13-12-14-17-31/h12-14,16-19,24H,21-23,25-28H2,1-11H3/t36-/m0/s1 |
| InChIKey | JAQDZUJRMDIPTM-BHVANESWSA-N |
| XLogP | 7.68 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.92 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|