C14H22N2O2 — CID 142774143
tert-butyl N-amino-N-[(3,4-dimethylphenyl)methyl]carbamate (PubChem CID 142774143) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is tert-butyl N-amino-N-[(3,4-dimethylphenyl)methyl]carbamate.
| Compound Name | tert-butyl N-amino-N-[(3,4-dimethylphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 142774143 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | tert-butyl N-amino-N-[(3,4-dimethylphenyl)methyl]carbamate |
| SMILES | Cc1ccc(CN(N)C(=O)OC(C)(C)C)cc1C |
| InChI | InChI=1S/C14H22N2O2/c1-10-6-7-12(8-11(10)2)9-16(15)13(17)18-14(3,4)5/h6-8H,9,15H2,1-5H3 |
| InChIKey | VZTHZYCXNVREMV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|